C16H26Cl2N4 — CID 154902532
3-[6-(2-azaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]cyclobutan-1-amine;dihydrochloride (PubChem CID 154902532) has the molecular formula C16H26Cl2N4 and a molecular weight of 345.32 g/mol. Its IUPAC name is 3-[6-(2-azaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]cyclobutan-1-amine;dihydrochloride.
| Compound Name | 3-[6-(2-azaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]cyclobutan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 154902532 |
| Molecular Formula | C16H26Cl2N4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-[6-(2-azaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]cyclobutan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CC(c2cc(N3CCC4(CCCC4)C3)ncn2)C1 |
| InChI | InChI=1S/C16H24N4.2ClH/c17-13-7-12(8-13)14-9-15(19-11-18-14)20-6-5-16(10-20)3-1-2-4-16;;/h9,11-13H,1-8,10,17H2;2*1H |
| InChIKey | MLOHIZIFNJOWLC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |