C14H26Cl2N4 — CID 154902483
6-(3-aminocyclobutyl)-N-(2-ethylbutyl)pyrimidin-4-amine;dihydrochloride (PubChem CID 154902483) has the molecular formula C14H26Cl2N4 and a molecular weight of 321.30 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-N-(2-ethylbutyl)pyrimidin-4-amine;dihydrochloride.
| Compound Name | 6-(3-aminocyclobutyl)-N-(2-ethylbutyl)pyrimidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154902483 |
| Molecular Formula | C14H26Cl2N4 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 6-(3-aminocyclobutyl)-N-(2-ethylbutyl)pyrimidin-4-amine;dihydrochloride |
| SMILES | CCC(CC)CNc1cc(C2CC(N)C2)ncn1.Cl.Cl |
| InChI | InChI=1S/C14H24N4.2ClH/c1-3-10(4-2)8-16-14-7-13(17-9-18-14)11-5-12(15)6-11;;/h7,9-12H,3-6,8,15H2,1-2H3,(H,16,17,18);2*1H |
| InChIKey | MKTRVOYOMYCJOO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |