C17H31Cl2N5O — CID 154902639
6-(3-aminocyclobutyl)-N-(5-morpholin-4-ylpentyl)pyrimidin-4-amine;dihydrochloride (PubChem CID 154902639) has the molecular formula C17H31Cl2N5O and a molecular weight of 392.38 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-N-(5-morpholin-4-ylpentyl)pyrimidin-4-amine;dihydrochloride.
| Compound Name | 6-(3-aminocyclobutyl)-N-(5-morpholin-4-ylpentyl)pyrimidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154902639 |
| Molecular Formula | C17H31Cl2N5O |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 6-(3-aminocyclobutyl)-N-(5-morpholin-4-ylpentyl)pyrimidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CC(c2cc(NCCCCCN3CCOCC3)ncn2)C1 |
| InChI | InChI=1S/C17H29N5O.2ClH/c18-15-10-14(11-15)16-12-17(21-13-20-16)19-4-2-1-3-5-22-6-8-23-9-7-22;;/h12-15H,1-11,18H2,(H,19,20,21);2*1H |
| InChIKey | FAEQAFZEGGLWEE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|