C20H27N5 — CID 91796010
6-(3-aminocyclobutyl)-N-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 91796010) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-N-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-(3-aminocyclobutyl)-N-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91796010 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 6-(3-aminocyclobutyl)-N-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | NC1CC(c2cc(NCc3cccc(CN4CCCC4)c3)ncn2)C1 |
| InChI | InChI=1S/C20H27N5/c21-18-9-17(10-18)19-11-20(24-14-23-19)22-12-15-4-3-5-16(8-15)13-25-6-1-2-7-25/h3-5,8,11,14,17-18H,1-2,6-7,9-10,12-13,21H2,(H,22,23,24) |
| InChIKey | OJCAMTWVKVFQMT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |