C20H28Cl2N6 — CID 154903125
6-(3-aminocyclobutyl)-N-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propyl]pyrimidin-4-amine;dihydrochloride (PubChem CID 154903125) has the molecular formula C20H28Cl2N6 and a molecular weight of 423.39 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-N-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propyl]pyrimidin-4-amine;dihydrochloride.
| Compound Name | 6-(3-aminocyclobutyl)-N-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propyl]pyrimidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154903125 |
| Molecular Formula | C20H28Cl2N6 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 6-(3-aminocyclobutyl)-N-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propyl]pyrimidin-4-amine;dihydrochloride |
| SMILES | Cc1ccc2[nH]c(CCCNc3cc(C4CC(N)C4)ncn3)nc2c1C.Cl.Cl |
| InChI | InChI=1S/C20H26N6.2ClH/c1-12-5-6-16-20(13(12)2)26-18(25-16)4-3-7-22-19-10-17(23-11-24-19)14-8-15(21)9-14;;/h5-6,10-11,14-15H,3-4,7-9,21H2,1-2H3,(H,25,26)(H,22,23,24);2*1H |
| InChIKey | GGJVKROIHNKWHG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|