C20H25NO4 — CID 91778220
3-(furan-2-yl)-1-[4-hydroxy-4-(hydroxymethyl)piperidin-1-yl]-4-phenylbutan-1-one (PubChem CID 91778220) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-[4-hydroxy-4-(hydroxymethyl)piperidin-1-yl]-4-phenylbutan-1-one.
| Compound Name | 3-(furan-2-yl)-1-[4-hydroxy-4-(hydroxymethyl)piperidin-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 91778220 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3-(furan-2-yl)-1-[4-hydroxy-4-(hydroxymethyl)piperidin-1-yl]-4-phenylbutan-1-one |
| SMILES | O=C(CC(Cc1ccccc1)c1ccco1)N1CCC(O)(CO)CC1 |
| InChI | InChI=1S/C20H25NO4/c22-15-20(24)8-10-21(11-9-20)19(23)14-17(18-7-4-12-25-18)13-16-5-2-1-3-6-16/h1-7,12,17,22,24H,8-11,13-15H2 |
| InChIKey | CBWJLJASWXYJMF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |