C17H19FN2O4 — CID 91782284
9-[2-(4-fluorophenyl)-2-hydroxyacetyl]-3,9-diazaspiro[5.5]undecane-2,4-dione (PubChem CID 91782284) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is 9-[2-(4-fluorophenyl)-2-hydroxyacetyl]-3,9-diazaspiro[5.5]undecane-2,4-dione.
| Compound Name | 9-[2-(4-fluorophenyl)-2-hydroxyacetyl]-3,9-diazaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 91782284 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 9-[2-(4-fluorophenyl)-2-hydroxyacetyl]-3,9-diazaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1CC2(CCN(C(=O)C(O)c3ccc(F)cc3)CC2)CC(=O)N1 |
| InChI | InChI=1S/C17H19FN2O4/c18-12-3-1-11(2-4-12)15(23)16(24)20-7-5-17(6-8-20)9-13(21)19-14(22)10-17/h1-4,15,23H,5-10H2,(H,19,21,22) |
| InChIKey | QRZOCXNPEMOKNT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|