About [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol
[1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol (PubChem CID 91787374) has the molecular formula C21H34N2O2
and a molecular weight of 346.51 g/mol. Its IUPAC name is [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol |
| PubChem CID | 91787374 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol |
| SMILES | COc1ccc(CN2CCC(CO)(CN3CCCC3)CC2)c(C)c1C |
| InChI | InChI=1S/C21H34N2O2/c1-17-18(2)20(25-3)7-6-19(17)14-22-12-8-21(16-24,9-13-22)15-23-10-4-5-11-23/h6-7,24H,4-5,8-16H2,1-3H3 |
| InChIKey | KIFQCBRROQPHNC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol?
The IUPAC name of [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol (CID 91787374) is [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol.
What is the SMILES notation for [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol?
The canonical SMILES for [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol is COc1ccc(CN2CCC(CO)(CN3CCCC3)CC2)c(C)c1C.
What is the InChIKey of [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol?
The InChIKey is KIFQCBRROQPHNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N2O2/c1-17-18(2)20(25-3)7-6-19(17)14-22-12-8-21(16-24,9-13-22)15-23-10-4-5-11-23/h6-7,24H,4-5,8-16H2,1-3H3.
What are the key properties of [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol?
[1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol has a molecular weight of 346.51 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol is sourced from PubChem (CID 91787374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).