C21H22Cl2N2O3 — CID 9178794
N-[(3R)-1-[3-(2,4-dichlorophenoxy)propyl]-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide (PubChem CID 9178794) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is N-[(3R)-1-[3-(2,4-dichlorophenoxy)propyl]-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide.
| Compound Name | N-[(3R)-1-[3-(2,4-dichlorophenoxy)propyl]-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide |
|---|---|
| PubChem CID | 9178794 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-[(3R)-1-[3-(2,4-dichlorophenoxy)propyl]-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(=O)N(CCCOc2ccc(Cl)cc2Cl)c2c(C)cc(C)cc21 |
| InChI | InChI=1S/C21H22Cl2N2O3/c1-12-9-13(2)20-16(10-12)19(24-14(3)26)21(27)25(20)7-4-8-28-18-6-5-15(22)11-17(18)23/h5-6,9-11,19H,4,7-8H2,1-3H3,(H,24,26)/t19-/m1/s1 |
| InChIKey | WPWWNBPDJHUMLY-LJQANCHMSA-N |
| XLogP | 4.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|