C17H18N6OS — CID 91789002
N-(1-pyrimidin-2-ylpiperidin-3-yl)-3-thiophen-3-yl-1H-pyrazole-5-carboxamide (PubChem CID 91789002) has the molecular formula C17H18N6OS and a molecular weight of 354.44 g/mol. Its IUPAC name is N-(1-pyrimidin-2-ylpiperidin-3-yl)-3-thiophen-3-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(1-pyrimidin-2-ylpiperidin-3-yl)-3-thiophen-3-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 91789002 |
| Molecular Formula | C17H18N6OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-(1-pyrimidin-2-ylpiperidin-3-yl)-3-thiophen-3-yl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NC1CCCN(c2ncccn2)C1)c1cc(-c2ccsc2)n[nH]1 |
| InChI | InChI=1S/C17H18N6OS/c24-16(15-9-14(21-22-15)12-4-8-25-11-12)20-13-3-1-7-23(10-13)17-18-5-2-6-19-17/h2,4-6,8-9,11,13H,1,3,7,10H2,(H,20,24)(H,21,22) |
| InChIKey | CGEGRWFBONRNCY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |