C16H25N7O — CID 91792134
3-[4-(2-methoxyethyl)-5-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-ylmethyl)-1,2,4-triazol-3-yl]cyclobutan-1-amine (PubChem CID 91792134) has the molecular formula C16H25N7O and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-[4-(2-methoxyethyl)-5-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-ylmethyl)-1,2,4-triazol-3-yl]cyclobutan-1-amine.
| Compound Name | 3-[4-(2-methoxyethyl)-5-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-ylmethyl)-1,2,4-triazol-3-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 91792134 |
| Molecular Formula | C16H25N7O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 3-[4-(2-methoxyethyl)-5-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-ylmethyl)-1,2,4-triazol-3-yl]cyclobutan-1-amine |
| SMILES | COCCn1c(CN2CCc3nc[nH]c3C2)nnc1C1CC(N)C1 |
| InChI | InChI=1S/C16H25N7O/c1-24-5-4-23-15(20-21-16(23)11-6-12(17)7-11)9-22-3-2-13-14(8-22)19-10-18-13/h10-12H,2-9,17H2,1H3,(H,18,19) |
| InChIKey | YQHXHQFXISIHEZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |