C18H17F2N3O2 — CID 91795003
N-[(1,5-dimethylindazol-3-yl)methyl]-2,6-difluoro-4-methoxybenzamide (PubChem CID 91795003) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is N-[(1,5-dimethylindazol-3-yl)methyl]-2,6-difluoro-4-methoxybenzamide.
| Compound Name | N-[(1,5-dimethylindazol-3-yl)methyl]-2,6-difluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 91795003 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[(1,5-dimethylindazol-3-yl)methyl]-2,6-difluoro-4-methoxybenzamide |
| SMILES | COc1cc(F)c(C(=O)NCc2nn(C)c3ccc(C)cc23)c(F)c1 |
| InChI | InChI=1S/C18H17F2N3O2/c1-10-4-5-16-12(6-10)15(22-23(16)2)9-21-18(24)17-13(19)7-11(25-3)8-14(17)20/h4-8H,9H2,1-3H3,(H,21,24) |
| InChIKey | GVMWYGUCMQDSKM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |