C17H20F3NO3 — CID 91795487
3-[1-[2-methyl-5-(trifluoromethyl)benzoyl]piperidin-3-yl]propanoic acid (PubChem CID 91795487) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 3-[1-[2-methyl-5-(trifluoromethyl)benzoyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[2-methyl-5-(trifluoromethyl)benzoyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 91795487 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-[1-[2-methyl-5-(trifluoromethyl)benzoyl]piperidin-3-yl]propanoic acid |
| SMILES | Cc1ccc(C(F)(F)F)cc1C(=O)N1CCCC(CCC(=O)O)C1 |
| InChI | InChI=1S/C17H20F3NO3/c1-11-4-6-13(17(18,19)20)9-14(11)16(24)21-8-2-3-12(10-21)5-7-15(22)23/h4,6,9,12H,2-3,5,7-8,10H2,1H3,(H,22,23) |
| InChIKey | UIUWSOXKWUQZPL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |