C15H13F5N2O3 — CID 91795512
N-[[3-(3-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 91795512) has the molecular formula C15H13F5N2O3 and a molecular weight of 364.27 g/mol. Its IUPAC name is N-[[3-(3-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[[3-(3-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 91795512 |
| Molecular Formula | C15H13F5N2O3 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-[[3-(3-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | O=C(COCC(F)(F)C(F)F)NCc1cc(-c2cccc(F)c2)no1 |
| InChI | InChI=1S/C15H13F5N2O3/c16-10-3-1-2-9(4-10)12-5-11(25-22-12)6-21-13(23)7-24-8-15(19,20)14(17)18/h1-5,14H,6-8H2,(H,21,23) |
| InChIKey | FXBLMBFUJCABRG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|