C19H20N4O — CID 91795549
2-(3-methylphenyl)-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]benzamide (PubChem CID 91795549) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]benzamide.
| Compound Name | 2-(3-methylphenyl)-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 91795549 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-(3-methylphenyl)-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]benzamide |
| SMILES | Cc1cccc(-c2ccccc2C(=O)NC(C)Cn2cncn2)c1 |
| InChI | InChI=1S/C19H20N4O/c1-14-6-5-7-16(10-14)17-8-3-4-9-18(17)19(24)22-15(2)11-23-13-20-12-21-23/h3-10,12-13,15H,11H2,1-2H3,(H,22,24) |
| InChIKey | NQFJPWJWJSKGNY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |