C12H11ClF2N4O — CID 91781642
2-chloro-4,5-difluoro-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]benzamide (PubChem CID 91781642) has the molecular formula C12H11ClF2N4O and a molecular weight of 300.70 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 91781642 |
| Molecular Formula | C12H11ClF2N4O |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]benzamide |
| SMILES | CC(Cn1cncn1)NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H11ClF2N4O/c1-7(4-19-6-16-5-17-19)18-12(20)8-2-10(14)11(15)3-9(8)13/h2-3,5-7H,4H2,1H3,(H,18,20) |
| InChIKey | KEAOQIKGARMEEF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|