C16H17ClN2O4S — CID 91795550
4-chloro-2-hydroxy-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]benzamide (PubChem CID 91795550) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is 4-chloro-2-hydroxy-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]benzamide.
| Compound Name | 4-chloro-2-hydroxy-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 91795550 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-chloro-2-hydroxy-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1OCc1cscn1)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C16H17ClN2O4S/c17-10-1-2-12(14(20)5-10)16(21)19-13-3-4-22-7-15(13)23-6-11-8-24-9-18-11/h1-2,5,8-9,13,15,20H,3-4,6-7H2,(H,19,21)/t13-,15-/m1/s1 |
| InChIKey | XHVHPIGERYDJLZ-UKRRQHHQSA-N |
| XLogP | 2.61 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |