C18H18N4O3S — CID 91789371
N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]quinoxaline-2-carboxamide (PubChem CID 91789371) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]quinoxaline-2-carboxamide.
| Compound Name | N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 91789371 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]quinoxaline-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1OCc1cscn1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C18H18N4O3S/c23-18(16-7-19-13-3-1-2-4-14(13)21-16)22-15-5-6-24-9-17(15)25-8-12-10-26-11-20-12/h1-4,7,10-11,15,17H,5-6,8-9H2,(H,22,23)/t15-,17-/m1/s1 |
| InChIKey | KSAUMBUYNIFWHR-NVXWUHKLSA-N |
| XLogP | 2.19 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |