C17H18N4O2S — CID 133266496
N-[(3S,4R)-4-(1,3-thiazol-4-ylmethoxy)oxan-3-yl]quinoxalin-2-amine (PubChem CID 133266496) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[(3S,4R)-4-(1,3-thiazol-4-ylmethoxy)oxan-3-yl]quinoxalin-2-amine.
| Compound Name | N-[(3S,4R)-4-(1,3-thiazol-4-ylmethoxy)oxan-3-yl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 133266496 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[(3S,4R)-4-(1,3-thiazol-4-ylmethoxy)oxan-3-yl]quinoxalin-2-amine |
| SMILES | c1ccc2nc(N[C@H]3COCC[C@H]3OCc3cscn3)cnc2c1 |
| InChI | InChI=1S/C17H18N4O2S/c1-2-4-14-13(3-1)18-7-17(20-14)21-15-9-22-6-5-16(15)23-8-12-10-24-11-19-12/h1-4,7,10-11,15-16H,5-6,8-9H2,(H,20,21)/t15-,16+/m0/s1 |
| InChIKey | OSNCKEMGIKHWMC-JKSUJKDBSA-N |
| XLogP | 2.87 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |