C19H27N5OS — CID 91795785
N-[3-[4-methyl-5-[(4,5,6,7-tetrahydro-1-benzothiophen-3-ylmethylamino)methyl]-1,2,4-triazol-3-yl]cyclobutyl]acetamide (PubChem CID 91795785) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is N-[3-[4-methyl-5-[(4,5,6,7-tetrahydro-1-benzothiophen-3-ylmethylamino)methyl]-1,2,4-triazol-3-yl]cyclobutyl]acetamide.
| Compound Name | N-[3-[4-methyl-5-[(4,5,6,7-tetrahydro-1-benzothiophen-3-ylmethylamino)methyl]-1,2,4-triazol-3-yl]cyclobutyl]acetamide |
|---|---|
| PubChem CID | 91795785 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[3-[4-methyl-5-[(4,5,6,7-tetrahydro-1-benzothiophen-3-ylmethylamino)methyl]-1,2,4-triazol-3-yl]cyclobutyl]acetamide |
| SMILES | CC(=O)NC1CC(c2nnc(CNCc3csc4c3CCCC4)n2C)C1 |
| InChI | InChI=1S/C19H27N5OS/c1-12(25)21-15-7-13(8-15)19-23-22-18(24(19)2)10-20-9-14-11-26-17-6-4-3-5-16(14)17/h11,13,15,20H,3-10H2,1-2H3,(H,21,25) |
| InChIKey | ZCFQDSMHOOERRI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |