C12H20N4OS — CID 91796403
N-methyl-N-(thian-4-yl)-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 91796403) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is N-methyl-N-(thian-4-yl)-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-methyl-N-(thian-4-yl)-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 91796403 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-methyl-N-(thian-4-yl)-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | CN(C(=O)CCCn1cncn1)C1CCSCC1 |
| InChI | InChI=1S/C12H20N4OS/c1-15(11-4-7-18-8-5-11)12(17)3-2-6-16-10-13-9-14-16/h9-11H,2-8H2,1H3 |
| InChIKey | NKJNUZACZVLCTG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |