C20H26N4O3 — CID 91796853
5-cyclohexyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]-1H-pyrazole-4-carboxamide (PubChem CID 91796853) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-cyclohexyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-cyclohexyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91796853 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 5-cyclohexyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1Oc1ccccn1)c1cn[nH]c1C1CCCCC1 |
| InChI | InChI=1S/C20H26N4O3/c25-20(15-12-22-24-19(15)14-6-2-1-3-7-14)23-16-9-11-26-13-17(16)27-18-8-4-5-10-21-18/h4-5,8,10,12,14,16-17H,1-3,6-7,9,11,13H2,(H,22,24)(H,23,25)/t16-,17-/m1/s1 |
| InChIKey | MKWXHOLAADRFCE-IAGOWNOFSA-N |
| XLogP | 2.82 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |