C16H20FN3O4 — CID 91796999
3-[[2-[(6-fluoro-1H-benzimidazol-2-yl)methoxy]acetyl]amino]-4-methylpentanoic acid (PubChem CID 91796999) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is 3-[[2-[(6-fluoro-1H-benzimidazol-2-yl)methoxy]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 3-[[2-[(6-fluoro-1H-benzimidazol-2-yl)methoxy]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 91796999 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-[[2-[(6-fluoro-1H-benzimidazol-2-yl)methoxy]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C(CC(=O)O)NC(=O)COCc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C16H20FN3O4/c1-9(2)12(6-16(22)23)20-15(21)8-24-7-14-18-11-4-3-10(17)5-13(11)19-14/h3-5,9,12H,6-8H2,1-2H3,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | QUXITRKBFQBGGD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |