C20H22FN3O2 — CID 68968543
benzyl N-[3-(6-fluoro-1H-benzimidazol-2-yl)-2,2-dimethylpropyl]carbamate (PubChem CID 68968543) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is benzyl N-[3-(6-fluoro-1H-benzimidazol-2-yl)-2,2-dimethylpropyl]carbamate.
| Compound Name | benzyl N-[3-(6-fluoro-1H-benzimidazol-2-yl)-2,2-dimethylpropyl]carbamate |
|---|---|
| PubChem CID | 68968543 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | benzyl N-[3-(6-fluoro-1H-benzimidazol-2-yl)-2,2-dimethylpropyl]carbamate |
| SMILES | CC(C)(CNC(=O)OCc1ccccc1)Cc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C20H22FN3O2/c1-20(2,11-18-23-16-9-8-15(21)10-17(16)24-18)13-22-19(25)26-12-14-6-4-3-5-7-14/h3-10H,11-13H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | KQIDBAYNGODNME-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |