C22H19ClFN7 — CID 91799540
6-[5-(2-chloro-4-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 91799540) has the molecular formula C22H19ClFN7 and a molecular weight of 435.89 g/mol. Its IUPAC name is 6-[5-(2-chloro-4-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[5-(2-chloro-4-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 91799540 |
| Molecular Formula | C22H19ClFN7 |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 6-[5-(2-chloro-4-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Cc1nc(-c2ccc(F)cc2Cl)c2c(N3CCc4nc(C5CC5)ncc4C3)ncnn12 |
| InChI | InChI=1S/C22H19ClFN7/c1-12-28-19(16-5-4-15(24)8-17(16)23)20-22(26-11-27-31(12)20)30-7-6-18-14(10-30)9-25-21(29-18)13-2-3-13/h4-5,8-9,11,13H,2-3,6-7,10H2,1H3 |
| InChIKey | QZJCVZCHEHLGQZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |