C39H24N2OS3+2 — CID 91801466
2,2'-diphenylspiro[[1,3]benzothiazolo[3,2-c][1,3]benzothiazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] (PubChem CID 91801466) has the molecular formula C39H24N2OS3+2 and a molecular weight of 632.84 g/mol. Its IUPAC name is 2,2'-diphenylspiro[[1,3]benzothiazolo[3,2-c][1,3]benzothiazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium].
| Compound Name | 2,2'-diphenylspiro[[1,3]benzothiazolo[3,2-c][1,3]benzothiazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 91801466 |
| Molecular Formula | C39H24N2OS3+2 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.10 |
| IUPAC Name | 2,2'-diphenylspiro[[1,3]benzothiazolo[3,2-c][1,3]benzothiazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
| SMILES | c1ccc(-c2ccc3c(c2)-c2sc4ccccc4[n+]2C2(O3)Sc3ccc(-c4ccccc4)cc3-c3sc4ccccc4[n+]32)cc1 |
| InChI | InChI=1S/C39H24N2OS3/c1-3-11-25(12-4-1)27-19-21-33-29(23-27)37-40(31-15-7-9-17-35(31)43-37)39(42-33)41-32-16-8-10-18-36(32)44-38(41)30-24-28(20-22-34(30)45-39)26-13-5-2-6-14-26/h1-24H/q+2 |
| InChIKey | SCSBETNLAUNCNT-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|