C24H18N5O3+ — CID 91802043
1H-benzimidazol-2-yl-[4-[3-(2-methoxy-3-pyridinyl)pyrazin-1-ium-2-yl]oxyphenyl]methanol (PubChem CID 91802043) has the molecular formula C24H18N5O3+ and a molecular weight of 424.44 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl-[4-[3-(2-methoxy-3-pyridinyl)pyrazin-1-ium-2-yl]oxyphenyl]methanol.
| Compound Name | 1H-benzimidazol-2-yl-[4-[3-(2-methoxy-3-pyridinyl)pyrazin-1-ium-2-yl]oxyphenyl]methanol |
|---|---|
| PubChem CID | 91802043 |
| Molecular Formula | C24H18N5O3+ |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1H-benzimidazol-2-yl-[4-[3-(2-methoxy-3-pyridinyl)pyrazin-1-ium-2-yl]oxyphenyl]methanol |
| SMILES | COc1ncccc1C1=NC=C=[N+]=C1Oc1ccc(C(O)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C24H18N5O3/c1-31-23-17(5-4-12-26-23)20-24(27-14-13-25-20)32-16-10-8-15(9-11-16)21(30)22-28-18-6-2-3-7-19(18)29-22/h2-13,21,30H,1H3,(H,28,29)/q+1 |
| InChIKey | HGMRSQJFKMDCTF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|