C41H46F2N4+2 — CID 91804982
6,7-diethyl-9,11-difluoro-7-[4-[4-(2-methylheptyl)phenyl]-5,6-diaza-9-azoniatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaen-8-yl]-6H-benzo[a]quinolizin-5-ium (PubChem CID 91804982) has the molecular formula C41H46F2N4+2 and a molecular weight of 632.84 g/mol. Its IUPAC name is 6,7-diethyl-9,11-difluoro-7-[4-[4-(2-methylheptyl)phenyl]-5,6-diaza-9-azoniatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaen-8-yl]-6H-benzo[a]quinolizin-5-ium.
| Compound Name | 6,7-diethyl-9,11-difluoro-7-[4-[4-(2-methylheptyl)phenyl]-5,6-diaza-9-azoniatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaen-8-yl]-6H-benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 91804982 |
| Molecular Formula | C41H46F2N4+2 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | 6,7-diethyl-9,11-difluoro-7-[4-[4-(2-methylheptyl)phenyl]-5,6-diaza-9-azoniatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaen-8-yl]-6H-benzo[a]quinolizin-5-ium |
| SMILES | CCCCCC(C)Cc1ccc(-c2cc3n(n2)CC(C2(CC)c4cc(F)cc(F)c4-c4cccc[n+]4C2CC)[n+]2ccccc2-3)cc1 |
| InChI | InChI=1S/C41H46F2N4/c1-5-8-9-14-28(4)23-29-17-19-30(20-18-29)34-26-37-35-15-10-12-21-45(35)39(27-47(37)44-34)41(7-3)32-24-31(42)25-33(43)40(32)36-16-11-13-22-46(36)38(41)6-2/h10-13,15-22,24-26,28,38-39H,5-9,14,23,27H2,1-4H3/q+2 |
| InChIKey | ATAAEOHKGGRDSW-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|