C24H24FN5 — CID 162650093
6-(2-fluoro-6-methylphenyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[4,3-c]pyridine (PubChem CID 162650093) has the molecular formula C24H24FN5 and a molecular weight of 401.49 g/mol. Its IUPAC name is 6-(2-fluoro-6-methylphenyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[4,3-c]pyridine.
| Compound Name | 6-(2-fluoro-6-methylphenyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 162650093 |
| Molecular Formula | C24H24FN5 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 6-(2-fluoro-6-methylphenyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[4,3-c]pyridine |
| SMILES | Cc1cccc(F)c1-c1cc2c(cn1)cnn2-c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C24H24FN5/c1-17-4-3-5-21(25)24(17)22-14-23-18(15-26-22)16-27-30(23)20-8-6-19(7-9-20)29-12-10-28(2)11-13-29/h3-9,14-16H,10-13H2,1-2H3 |
| InChIKey | YQMZHBNKYYDQAW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|