C24H22ClNO2 — CID 91805545
1-[(3-chlorophenyl)-(3-phenylmethoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 91805545) has the molecular formula C24H22ClNO2 and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-(3-phenylmethoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 1-[(3-chlorophenyl)-(3-phenylmethoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91805545 |
| Molecular Formula | C24H22ClNO2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-[(3-chlorophenyl)-(3-phenylmethoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C(c1cccc(Cl)c1)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H22ClNO2/c25-21-11-4-9-19(15-21)24(26-14-6-13-23(26)27)20-10-5-12-22(16-20)28-17-18-7-2-1-3-8-18/h1-5,7-12,15-16,24H,6,13-14,17H2 |
| InChIKey | PYOHBMSWAKKGLA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |