C18H12ClF6NO — CID 91806273
1-[3-[2-chloro-6-(trifluoromethyl)phenyl]-5-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 91806273) has the molecular formula C18H12ClF6NO and a molecular weight of 407.74 g/mol. Its IUPAC name is 1-[3-[2-chloro-6-(trifluoromethyl)phenyl]-5-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[2-chloro-6-(trifluoromethyl)phenyl]-5-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91806273 |
| Molecular Formula | C18H12ClF6NO |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 1-[3-[2-chloro-6-(trifluoromethyl)phenyl]-5-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1cc(-c2c(Cl)cccc2C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12ClF6NO/c19-14-4-1-3-13(18(23,24)25)16(14)10-7-11(17(20,21)22)9-12(8-10)26-6-2-5-15(26)27/h1,3-4,7-9H,2,5-6H2 |
| InChIKey | JFUMPVNRTULFFI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |