C14H18N2 — CID 91808049
(2R,5S,7R)-2-pyridin-3-yl-1-azatricyclo[3.3.1.13,7]decane (PubChem CID 91808049) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2R,5S,7R)-2-pyridin-3-yl-1-azatricyclo[3.3.1.13,7]decane.
| Compound Name | (2R,5S,7R)-2-pyridin-3-yl-1-azatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 91808049 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (2R,5S,7R)-2-pyridin-3-yl-1-azatricyclo[3.3.1.13,7]decane |
| SMILES | c1cncc([C@H]2C3C[C@@H]4C[C@H](C3)CN2C4)c1 |
| InChI | InChI=1S/C14H18N2/c1-2-12(7-15-3-1)14-13-5-10-4-11(6-13)9-16(14)8-10/h1-3,7,10-11,13-14H,4-6,8-9H2/t10-,11+,13?,14-/m0/s1 |
| InChIKey | INDYXBQOPZTSTJ-OWZDMKDPSA-N |
| XLogP | 2.48 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |