C13H18N2 — CID 21094254
7-pyridin-3-yl-1-azabicyclo[3.2.2]nonane (PubChem CID 21094254) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 7-pyridin-3-yl-1-azabicyclo[3.2.2]nonane.
| Compound Name | 7-pyridin-3-yl-1-azabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 21094254 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 7-pyridin-3-yl-1-azabicyclo[3.2.2]nonane |
| SMILES | c1cncc(C2CC3CCCN2CC3)c1 |
| InChI | InChI=1S/C13H18N2/c1-4-12(10-14-6-1)13-9-11-3-2-7-15(13)8-5-11/h1,4,6,10-11,13H,2-3,5,7-9H2 |
| InChIKey | BXZMIGKZXVFLGL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |