C28H29N3O6 — CID 91808203
N-(2-hydroxyethyl)-4-[1-[4-(1,2-oxazol-3-yl)phenyl]-4,5-dioxo-2-pentan-3-ylpyrrolidine-3-carbonyl]benzamide (PubChem CID 91808203) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-[1-[4-(1,2-oxazol-3-yl)phenyl]-4,5-dioxo-2-pentan-3-ylpyrrolidine-3-carbonyl]benzamide.
| Compound Name | N-(2-hydroxyethyl)-4-[1-[4-(1,2-oxazol-3-yl)phenyl]-4,5-dioxo-2-pentan-3-ylpyrrolidine-3-carbonyl]benzamide |
|---|---|
| PubChem CID | 91808203 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | N-(2-hydroxyethyl)-4-[1-[4-(1,2-oxazol-3-yl)phenyl]-4,5-dioxo-2-pentan-3-ylpyrrolidine-3-carbonyl]benzamide |
| SMILES | CCC(CC)C1C(C(=O)c2ccc(C(=O)NCCO)cc2)C(=O)C(=O)N1c1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C28H29N3O6/c1-3-17(4-2)24-23(25(33)19-5-7-20(8-6-19)27(35)29-14-15-32)26(34)28(36)31(24)21-11-9-18(10-12-21)22-13-16-37-30-22/h5-13,16-17,23-24,32H,3-4,14-15H2,1-2H3,(H,29,35) |
| InChIKey | FRUGYWQPFGZXNP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|