C27H30N2O4S — CID 91808530
1-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-4-(3-methylbutanoyl)-5-(2-propan-2-yloxyphenyl)pyrrolidine-2,3-dione (PubChem CID 91808530) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is 1-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-4-(3-methylbutanoyl)-5-(2-propan-2-yloxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-4-(3-methylbutanoyl)-5-(2-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808530 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-4-(3-methylbutanoyl)-5-(2-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CC(C)CC(=O)C1C(=O)C(=O)N(c2ccc(C3=NCCS3)cc2)C1c1ccccc1OC(C)C |
| InChI | InChI=1S/C27H30N2O4S/c1-16(2)15-21(30)23-24(20-7-5-6-8-22(20)33-17(3)4)29(27(32)25(23)31)19-11-9-18(10-12-19)26-28-13-14-34-26/h5-12,16-17,23-24H,13-15H2,1-4H3 |
| InChIKey | DUACVKBUNMEQDX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|