C28H29NO5S — CID 91808499
5-[2-(2-hydroxyethoxy)phenyl]-4-(3-methylbutanoyl)-1-[4-(5-methylthiophen-3-yl)phenyl]pyrrolidine-2,3-dione (PubChem CID 91808499) has the molecular formula C28H29NO5S and a molecular weight of 491.61 g/mol. Its IUPAC name is 5-[2-(2-hydroxyethoxy)phenyl]-4-(3-methylbutanoyl)-1-[4-(5-methylthiophen-3-yl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 5-[2-(2-hydroxyethoxy)phenyl]-4-(3-methylbutanoyl)-1-[4-(5-methylthiophen-3-yl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808499 |
| Molecular Formula | C28H29NO5S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 5-[2-(2-hydroxyethoxy)phenyl]-4-(3-methylbutanoyl)-1-[4-(5-methylthiophen-3-yl)phenyl]pyrrolidine-2,3-dione |
| SMILES | Cc1cc(-c2ccc(N3C(=O)C(=O)C(C(=O)CC(C)C)C3c3ccccc3OCCO)cc2)cs1 |
| InChI | InChI=1S/C28H29NO5S/c1-17(2)14-23(31)25-26(22-6-4-5-7-24(22)34-13-12-30)29(28(33)27(25)32)21-10-8-19(9-11-21)20-15-18(3)35-16-20/h4-11,15-17,25-26,30H,12-14H2,1-3H3 |
| InChIKey | CFQMAXKBAWBIDJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|