C18H14BF3KN — CID 91809673
potassium trifluoro-[4-(N-phenylanilino)phenyl]boranuide (PubChem CID 91809673) has the molecular formula C18H14BF3KN and a molecular weight of 351.22 g/mol. Its IUPAC name is potassium trifluoro-[4-(N-phenylanilino)phenyl]boranuide.
| Compound Name | potassium trifluoro-[4-(N-phenylanilino)phenyl]boranuide |
|---|---|
| PubChem CID | 91809673 |
| Molecular Formula | C18H14BF3KN |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | potassium trifluoro-[4-(N-phenylanilino)phenyl]boranuide |
| SMILES | F[B-](F)(F)c1ccc(N(c2ccccc2)c2ccccc2)cc1.[K+] |
| InChI | InChI=1S/C18H14BF3N.K/c20-19(21,22)15-11-13-18(14-12-15)23(16-7-3-1-4-8-16)17-9-5-2-6-10-17;/h1-14H;/q-1;+1 |
| InChIKey | LVLFZQHJZORNMT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|