C9H9ClN2O2 — CID 91811783
3-chloro-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid (PubChem CID 91811783) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is 3-chloro-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid.
| Compound Name | 3-chloro-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid |
|---|---|
| PubChem CID | 91811783 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 3-chloro-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid |
| SMILES | O=C(O)C1CCc2nnc(Cl)cc2C1 |
| InChI | InChI=1S/C9H9ClN2O2/c10-8-4-6-3-5(9(13)14)1-2-7(6)11-12-8/h4-5H,1-3H2,(H,13,14) |
| InChIKey | OXAORJYAGTVYSW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |