C19H18N6O — CID 91813872
4-pyrrol-1-yl-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]benzamide (PubChem CID 91813872) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-pyrrol-1-yl-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]benzamide.
| Compound Name | 4-pyrrol-1-yl-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]benzamide |
|---|---|
| PubChem CID | 91813872 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-pyrrol-1-yl-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]benzamide |
| SMILES | O=C(NCCCc1cnc2ncnn2c1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C19H18N6O/c26-18(16-5-7-17(8-6-16)24-10-1-2-11-24)20-9-3-4-15-12-21-19-22-14-23-25(19)13-15/h1-2,5-8,10-14H,3-4,9H2,(H,20,26) |
| InChIKey | JKDIKZIPZZLGAR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|