C30H32NO10- — CID 91820394
(4aS,5S,12aS)-2-carbamoyl-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-4a,5,10,11,12a-pentahydroxy-8-methoxy-3,12-dioxo-4,5-dihydrotetracen-1-olate (PubChem CID 91820394) has the molecular formula C30H32NO10- and a molecular weight of 566.58 g/mol. Its IUPAC name is (4aS,5S,12aS)-2-carbamoyl-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-4a,5,10,11,12a-pentahydroxy-8-methoxy-3,12-dioxo-4,5-dihydrotetracen-1-olate.
| Compound Name | (4aS,5S,12aS)-2-carbamoyl-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-4a,5,10,11,12a-pentahydroxy-8-methoxy-3,12-dioxo-4,5-dihydrotetracen-1-olate |
|---|---|
| PubChem CID | 91820394 |
| Molecular Formula | C30H32NO10- |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | (4aS,5S,12aS)-2-carbamoyl-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-4a,5,10,11,12a-pentahydroxy-8-methoxy-3,12-dioxo-4,5-dihydrotetracen-1-olate |
| SMILES | COc1cc(O)c2c(O)c3c(c(C/C=C(\C)CCC=C(C)C)c2c1)[C@H](O)[C@@]1(O)CC(=O)C(C(N)=O)=C([O-])[C@@]1(O)C3=O |
| InChI | InChI=1S/C30H33NO10/c1-13(2)6-5-7-14(3)8-9-16-17-10-15(41-4)11-18(32)20(17)24(34)23-21(16)25(35)29(39)12-19(33)22(28(31)38)26(36)30(29,40)27(23)37/h6,8,10-11,25,32,34-36,39-40H,5,7,9,12H2,1-4H3,(H2,31,38)/p-1/b14-8+/t25-,29-,30+/m0/s1 |
| InChIKey | AGMPGRYRWNVPEQ-BJTDMJNKSA-M |
| XLogP | 1.26 |
| TPSA | 210.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|