C20H25FN4O5 — CID 91821646
ethyl 4-[3-[1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 91821646) has the molecular formula C20H25FN4O5 and a molecular weight of 420.44 g/mol. Its IUPAC name is ethyl 4-[3-[1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91821646 |
| Molecular Formula | C20H25FN4O5 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | ethyl 4-[3-[1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCC2NC(=O)N(Cc3cccc(F)c3)C2=O)CC1 |
| InChI | InChI=1S/C20H25FN4O5/c1-2-30-20(29)24-10-8-23(9-11-24)17(26)7-6-16-18(27)25(19(28)22-16)13-14-4-3-5-15(21)12-14/h3-5,12,16H,2,6-11,13H2,1H3,(H,22,28) |
| InChIKey | XNSCKGKQZBRMAP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|