C18H24ClN3O4 — CID 91823474
2-[1-[(3-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-hydroxy-3-methylpentan-2-yl)acetamide (PubChem CID 91823474) has the molecular formula C18H24ClN3O4 and a molecular weight of 381.86 g/mol. Its IUPAC name is 2-[1-[(3-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-hydroxy-3-methylpentan-2-yl)acetamide.
| Compound Name | 2-[1-[(3-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-hydroxy-3-methylpentan-2-yl)acetamide |
|---|---|
| PubChem CID | 91823474 |
| Molecular Formula | C18H24ClN3O4 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[1-[(3-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-hydroxy-3-methylpentan-2-yl)acetamide |
| SMILES | CCC(C)C(CO)NC(=O)CC1NC(=O)N(Cc2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C18H24ClN3O4/c1-3-11(2)15(10-23)20-16(24)8-14-17(25)22(18(26)21-14)9-12-5-4-6-13(19)7-12/h4-7,11,14-15,23H,3,8-10H2,1-2H3,(H,20,24)(H,21,26) |
| InChIKey | GUCVUFLGYKMFSD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|