C19H21F2NO5S — CID 91826157
2-[(E)-(2,6-difluoro-4-methoxyphenyl)methylideneamino]oxybutyl 4-methylbenzenesulfonate (PubChem CID 91826157) has the molecular formula C19H21F2NO5S and a molecular weight of 413.44 g/mol. Its IUPAC name is 2-[(E)-(2,6-difluoro-4-methoxyphenyl)methylideneamino]oxybutyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(E)-(2,6-difluoro-4-methoxyphenyl)methylideneamino]oxybutyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91826157 |
| Molecular Formula | C19H21F2NO5S |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[(E)-(2,6-difluoro-4-methoxyphenyl)methylideneamino]oxybutyl 4-methylbenzenesulfonate |
| SMILES | CCC(COS(=O)(=O)c1ccc(C)cc1)O/N=C/c1c(F)cc(OC)cc1F |
| InChI | InChI=1S/C19H21F2NO5S/c1-4-14(12-26-28(23,24)16-7-5-13(2)6-8-16)27-22-11-17-18(20)9-15(25-3)10-19(17)21/h5-11,14H,4,12H2,1-3H3/b22-11+ |
| InChIKey | BFZDFVTWQZZAHT-SSDVNMTOSA-N |
| XLogP | 3.82 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|