C19H22FNO5S — CID 91826184
2-[(E)-(2-fluoro-6-methoxyphenyl)methylideneamino]oxybutyl 4-methylbenzenesulfonate (PubChem CID 91826184) has the molecular formula C19H22FNO5S and a molecular weight of 395.45 g/mol. Its IUPAC name is 2-[(E)-(2-fluoro-6-methoxyphenyl)methylideneamino]oxybutyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(E)-(2-fluoro-6-methoxyphenyl)methylideneamino]oxybutyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91826184 |
| Molecular Formula | C19H22FNO5S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-[(E)-(2-fluoro-6-methoxyphenyl)methylideneamino]oxybutyl 4-methylbenzenesulfonate |
| SMILES | CCC(COS(=O)(=O)c1ccc(C)cc1)O/N=C/c1c(F)cccc1OC |
| InChI | InChI=1S/C19H22FNO5S/c1-4-15(13-25-27(22,23)16-10-8-14(2)9-11-16)26-21-12-17-18(20)6-5-7-19(17)24-3/h5-12,15H,4,13H2,1-3H3/b21-12+ |
| InChIKey | IQUJLPFRQSEIFY-CIAFOILYSA-N |
| XLogP | 3.68 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|