C19H20F3NO4S — CID 71668411
[(Z)-[2,2,2-trifluoro-1-(2-methoxy-3-propan-2-ylphenyl)ethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 71668411) has the molecular formula C19H20F3NO4S and a molecular weight of 415.43 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-(2-methoxy-3-propan-2-ylphenyl)ethylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-(2-methoxy-3-propan-2-ylphenyl)ethylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71668411 |
| Molecular Formula | C19H20F3NO4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-(2-methoxy-3-propan-2-ylphenyl)ethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | COc1c(/C(=N/OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cccc1C(C)C |
| InChI | InChI=1S/C19H20F3NO4S/c1-12(2)15-6-5-7-16(17(15)26-4)18(19(20,21)22)23-27-28(24,25)14-10-8-13(3)9-11-14/h5-12H,1-4H3/b23-18- |
| InChIKey | OEKKTEIZSOCFPZ-NKFKGCMQSA-N |
| XLogP | 4.80 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|