C19H18F3NO5S — CID 23591349
[(Z)-[2,2,2-trifluoro-1-[4-(3-oxobutoxy)phenyl]ethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 23591349) has the molecular formula C19H18F3NO5S and a molecular weight of 429.42 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-[4-(3-oxobutoxy)phenyl]ethylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-[4-(3-oxobutoxy)phenyl]ethylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23591349 |
| Molecular Formula | C19H18F3NO5S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-[4-(3-oxobutoxy)phenyl]ethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | CC(=O)CCOc1ccc(/C(=N/OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3NO5S/c1-13-3-9-17(10-4-13)29(25,26)28-23-18(19(20,21)22)15-5-7-16(8-6-15)27-12-11-14(2)24/h3-10H,11-12H2,1-2H3/b23-18- |
| InChIKey | VVJHLTATKRDZRI-NKFKGCMQSA-N |
| XLogP | 4.02 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|