C23H24F6N2O6S — CID 20670623
[(Z)-[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] propane-1-sulfonate (PubChem CID 20670623) has the molecular formula C23H24F6N2O6S and a molecular weight of 570.51 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] propane-1-sulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] propane-1-sulfonate |
|---|---|
| PubChem CID | 20670623 |
| Molecular Formula | C23H24F6N2O6S |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)O/N=C(/c1ccc(OCCCOc2ccc(/C(=N/OC)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H24F6N2O6S/c1-3-15-38(32,33)37-31-21(23(27,28)29)17-7-11-19(12-8-17)36-14-4-13-35-18-9-5-16(6-10-18)20(30-34-2)22(24,25)26/h5-12H,3-4,13-15H2,1-2H3/b30-20-,31-21- |
| InChIKey | REQDZCWYUSFQSA-LONJPSTNSA-N |
| XLogP | 5.47 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|