C10H12N2O4S — CID 11043347
3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-sulfonamide (PubChem CID 11043347) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-sulfonamide.
| Compound Name | 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-sulfonamide |
|---|---|
| PubChem CID | 11043347 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-sulfonamide |
| SMILES | COc1ccc(C2=NOC(S(N)(=O)=O)C2)cc1 |
| InChI | InChI=1S/C10H12N2O4S/c1-15-8-4-2-7(3-5-8)9-6-10(16-12-9)17(11,13)14/h2-5,10H,6H2,1H3,(H2,11,13,14) |
| InChIKey | DXLUZMFVIJMZRH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |