C24H18F6N2O7S2 — CID 20670624
3-O-[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 1-O-[(Z)-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] benzene-1,3-disulfonate (PubChem CID 20670624) has the molecular formula C24H18F6N2O7S2 and a molecular weight of 624.54 g/mol. Its IUPAC name is 3-O-[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 1-O-[(Z)-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] benzene-1,3-disulfonate.
| Compound Name | 3-O-[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 1-O-[(Z)-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 20670624 |
| Molecular Formula | C24H18F6N2O7S2 |
| Molecular Weight | 624.54 g/mol |
| Exact Mass | 624.05 |
| IUPAC Name | 3-O-[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 1-O-[(Z)-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] benzene-1,3-disulfonate |
| SMILES | COc1ccc(/C(=N/OS(=O)(=O)c2cccc(S(=O)(=O)O/N=C(/c3ccc(C)cc3)C(F)(F)F)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H18F6N2O7S2/c1-15-6-8-16(9-7-15)21(23(25,26)27)31-38-40(33,34)19-4-3-5-20(14-19)41(35,36)39-32-22(24(28,29)30)17-10-12-18(37-2)13-11-17/h3-14H,1-2H3/b31-21-,32-22- |
| InChIKey | FBEHPJGTRDBCCH-RYJWMXFHSA-N |
| XLogP | 5.35 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|