C22H26F3NO4S — CID 71668422
[(E)-[2,2,2-trifluoro-1-[4-methoxy-3,5-di(propan-2-yl)phenyl]ethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 71668422) has the molecular formula C22H26F3NO4S and a molecular weight of 457.51 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-[4-methoxy-3,5-di(propan-2-yl)phenyl]ethylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-[4-methoxy-3,5-di(propan-2-yl)phenyl]ethylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71668422 |
| Molecular Formula | C22H26F3NO4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-[4-methoxy-3,5-di(propan-2-yl)phenyl]ethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | COc1c(C(C)C)cc(/C(=N\OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cc1C(C)C |
| InChI | InChI=1S/C22H26F3NO4S/c1-13(2)18-11-16(12-19(14(3)4)20(18)29-6)21(22(23,24)25)26-30-31(27,28)17-9-7-15(5)8-10-17/h7-14H,1-6H3/b26-21+ |
| InChIKey | ZILLAQWTTFWVOC-YYADALCUSA-N |
| XLogP | 5.92 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|